C11H16N4O — CID 11558383
N-(2H-benzotriazol-5-ylmethyl)-3-methoxypropan-1-amine (PubChem CID 11558383) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is N-(2H-benzotriazol-5-ylmethyl)-3-methoxypropan-1-amine.
| Compound Name | N-(2H-benzotriazol-5-ylmethyl)-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 11558383 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | N-(2H-benzotriazol-5-ylmethyl)-3-methoxypropan-1-amine |
| SMILES | COCCCNCc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C11H16N4O/c1-16-6-2-5-12-8-9-3-4-10-11(7-9)14-15-13-10/h3-4,7,12H,2,5-6,8H2,1H3,(H,13,14,15) |
| InChIKey | OHYPAWHVARAKRY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|