About 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine
3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine (PubChem CID 115765551) has the molecular formula C12H16N2OS
and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine |
| PubChem CID | 115765551 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine |
| SMILES | COCCCNCc1cnc2ccsc2c1 |
| InChI | InChI=1S/C12H16N2OS/c1-15-5-2-4-13-8-10-7-12-11(14-9-10)3-6-16-12/h3,6-7,9,13H,2,4-5,8H2,1H3 |
| InChIKey | ZTLUQFJVQPHQBV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine?
The IUPAC name of 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine (CID 115765551) is 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine.
What is the SMILES notation for 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine?
The canonical SMILES for 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine is COCCCNCc1cnc2ccsc2c1.
What is the InChIKey of 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine?
The InChIKey is ZTLUQFJVQPHQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2OS/c1-15-5-2-4-13-8-10-7-12-11(14-9-10)3-6-16-12/h3,6-7,9,13H,2,4-5,8H2,1H3.
What are the key properties of 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine?
3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine has a molecular weight of 236.34 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-1-amine is sourced from PubChem (CID 115765551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).