C21H40N2O3 — CID 165476539
tert-butyl 4-[4-(cyclohexylamino)-1-hydroxybutan-2-yl]-3-methylpiperidine-1-carboxylate (PubChem CID 165476539) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is tert-butyl 4-[4-(cyclohexylamino)-1-hydroxybutan-2-yl]-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(cyclohexylamino)-1-hydroxybutan-2-yl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 165476539 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | tert-butyl 4-[4-(cyclohexylamino)-1-hydroxybutan-2-yl]-3-methylpiperidine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCC1C(CO)CCNC1CCCCC1 |
| InChI | InChI=1S/C21H40N2O3/c1-16-14-23(20(25)26-21(2,3)4)13-11-19(16)17(15-24)10-12-22-18-8-6-5-7-9-18/h16-19,22,24H,5-15H2,1-4H3 |
| InChIKey | ACKSHTAXUCPVGC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |