C14H26INO2 — CID 171807582
tert-butyl (4R)-4-(1-iodopropan-2-yl)-3-methylpiperidine-1-carboxylate (PubChem CID 171807582) has the molecular formula C14H26INO2 and a molecular weight of 367.27 g/mol. Its IUPAC name is tert-butyl (4R)-4-(1-iodopropan-2-yl)-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-(1-iodopropan-2-yl)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 171807582 |
| Molecular Formula | C14H26INO2 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | tert-butyl (4R)-4-(1-iodopropan-2-yl)-3-methylpiperidine-1-carboxylate |
| SMILES | CC(CI)[C@@H]1CCN(C(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C14H26INO2/c1-10(8-15)12-6-7-16(9-11(12)2)13(17)18-14(3,4)5/h10-12H,6-9H2,1-5H3/t10?,11?,12-/m0/s1 |
| InChIKey | RPMOUBPGEHSDIM-MCIGGMRASA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|