C11H11F2N3O2 — CID 165476740
2,2-difluoro-2-[4-(4-methoxyphenyl)triazol-1-yl]ethanol (PubChem CID 165476740) has the molecular formula C11H11F2N3O2 and a molecular weight of 255.22 g/mol. Its IUPAC name is 2,2-difluoro-2-[4-(4-methoxyphenyl)triazol-1-yl]ethanol.
| Compound Name | 2,2-difluoro-2-[4-(4-methoxyphenyl)triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 165476740 |
| Molecular Formula | C11H11F2N3O2 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2,2-difluoro-2-[4-(4-methoxyphenyl)triazol-1-yl]ethanol |
| SMILES | COc1ccc(-c2cn(C(F)(F)CO)nn2)cc1 |
| InChI | InChI=1S/C11H11F2N3O2/c1-18-9-4-2-8(3-5-9)10-6-16(15-14-10)11(12,13)7-17/h2-6,17H,7H2,1H3 |
| InChIKey | VCGSDLZHZFLBSU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |