C12H24N2 — CID 165477844
N-butan-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-amine (PubChem CID 165477844) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N-butan-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-amine.
| Compound Name | N-butan-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-amine |
|---|---|
| PubChem CID | 165477844 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-butan-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-amine |
| SMILES | CCC(C)NC1CC2CCCCN2C1 |
| InChI | InChI=1S/C12H24N2/c1-3-10(2)13-11-8-12-6-4-5-7-14(12)9-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | OQQQXHDOJJQBCT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |