C22H27BrN2O3S — CID 16548256
N-[1-(4-bromophenyl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 16548256) has the molecular formula C22H27BrN2O3S and a molecular weight of 479.44 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 16548256 |
| Molecular Formula | C22H27BrN2O3S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)NC(C)c3ccc(Br)cc3)c2)C1 |
| InChI | InChI=1S/C22H27BrN2O3S/c1-15-11-16(2)14-25(13-15)29(27,28)21-6-4-5-19(12-21)22(26)24-17(3)18-7-9-20(23)10-8-18/h4-10,12,15-17H,11,13-14H2,1-3H3,(H,24,26) |
| InChIKey | DZGUPXHKHQYQAV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |