C23H28N4O3S — CID 60620449
N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 60620449) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 60620449 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)N[C@@H](C)c3nc4ccccc4[nH]3)c2)C1 |
| InChI | InChI=1S/C23H28N4O3S/c1-15-11-16(2)14-27(13-15)31(29,30)19-8-6-7-18(12-19)23(28)24-17(3)22-25-20-9-4-5-10-21(20)26-22/h4-10,12,15-17H,11,13-14H2,1-3H3,(H,24,28)(H,25,26)/t15?,16?,17-/m0/s1 |
| InChIKey | UOXIXCVRYKEUQC-JCYILVPMSA-N |
| XLogP | 3.72 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |