C11H18INO — CID 165483064
2'-(iodomethyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-oxolane] (PubChem CID 165483064) has the molecular formula C11H18INO and a molecular weight of 307.18 g/mol. Its IUPAC name is 2'-(iodomethyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-oxolane].
| Compound Name | 2'-(iodomethyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-oxolane] |
|---|---|
| PubChem CID | 165483064 |
| Molecular Formula | C11H18INO |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2'-(iodomethyl)spiro[8-azabicyclo[3.2.1]octane-3,3'-oxolane] |
| SMILES | ICC1OCCC12CC1CCC(C2)N1 |
| InChI | InChI=1S/C11H18INO/c12-7-10-11(3-4-14-10)5-8-1-2-9(6-11)13-8/h8-10,13H,1-7H2 |
| InChIKey | ICGVHIKZQZPRDF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|