C13H23NO3 — CID 171958451
3-[2-(1,3-dioxan-2-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171958451) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-[2-(1,3-dioxan-2-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[2-(1,3-dioxan-2-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171958451 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 3-[2-(1,3-dioxan-2-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(CCC2OCCCO2)CC2CCC(C1)N2 |
| InChI | InChI=1S/C13H23NO3/c15-13(5-4-12-16-6-1-7-17-12)8-10-2-3-11(9-13)14-10/h10-12,14-15H,1-9H2 |
| InChIKey | DWKNGJMESMNYKH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |