About 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine
4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine (PubChem CID 165483095) has the molecular formula C13H17ClN2S
and a molecular weight of 268.81 g/mol. Its IUPAC name is 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine |
| PubChem CID | 165483095 |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine |
| SMILES | CCc1c(C)sc2nc(CC(C)C)nc(Cl)c12 |
| InChI | InChI=1S/C13H17ClN2S/c1-5-9-8(4)17-13-11(9)12(14)15-10(16-13)6-7(2)3/h7H,5-6H2,1-4H3 |
| InChIKey | ZVSOBMFNHBBJFD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine?
The IUPAC name of 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine (CID 165483095) is 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine?
The canonical SMILES for 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine is CCc1c(C)sc2nc(CC(C)C)nc(Cl)c12.
What is the InChIKey of 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine?
The InChIKey is ZVSOBMFNHBBJFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2S/c1-5-9-8(4)17-13-11(9)12(14)15-10(16-13)6-7(2)3/h7H,5-6H2,1-4H3.
What are the key properties of 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine?
4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine has a molecular weight of 268.81 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-ethyl-6-methyl-2-(2-methylpropyl)thieno[2,3-d]pyrimidine is sourced from PubChem (CID 165483095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).