C17H15NO2S — CID 16548614
(4-cyanophenyl) 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 16548614) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is (4-cyanophenyl) 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | (4-cyanophenyl) 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 16548614 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (4-cyanophenyl) 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | CC1CCc2sc(C(=O)Oc3ccc(C#N)cc3)cc2C1 |
| InChI | InChI=1S/C17H15NO2S/c1-11-2-7-15-13(8-11)9-16(21-15)17(19)20-14-5-3-12(10-18)4-6-14/h3-6,9,11H,2,7-8H2,1H3 |
| InChIKey | GJPVAKRZSSGXEV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|