C11H10N2O2S — CID 165487009
5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)thiophene-2-carbaldehyde (PubChem CID 165487009) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)thiophene-2-carbaldehyde.
| Compound Name | 5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 165487009 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2noc(C3CCC3)n2)s1 |
| InChI | InChI=1S/C11H10N2O2S/c14-6-8-4-5-9(16-8)10-12-11(15-13-10)7-2-1-3-7/h4-7H,1-3H2 |
| InChIKey | RMQLPILQCNSIFA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|