C11H14N2O4S — CID 165487424
tert-butyl 2,2-dioxo-1,3-dihydro-2λ6,1,3-benzothiadiazole-5-carboxylate (PubChem CID 165487424) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is tert-butyl 2,2-dioxo-1,3-dihydro-2λ6,1,3-benzothiadiazole-5-carboxylate.
| Compound Name | tert-butyl 2,2-dioxo-1,3-dihydro-2λ6,1,3-benzothiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 165487424 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | tert-butyl 2,2-dioxo-1,3-dihydro-2λ6,1,3-benzothiadiazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(c1)NS(=O)(=O)N2 |
| InChI | InChI=1S/C11H14N2O4S/c1-11(2,3)17-10(14)7-4-5-8-9(6-7)13-18(15,16)12-8/h4-6,12-13H,1-3H3 |
| InChIKey | FXEGUKRFXKNYJD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|