C13H21N5 — CID 165488302
4-[5-(1,2,3,6-tetrahydropyridin-4-yl)triazol-1-yl]azepane (PubChem CID 165488302) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is 4-[5-(1,2,3,6-tetrahydropyridin-4-yl)triazol-1-yl]azepane.
| Compound Name | 4-[5-(1,2,3,6-tetrahydropyridin-4-yl)triazol-1-yl]azepane |
|---|---|
| PubChem CID | 165488302 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 4-[5-(1,2,3,6-tetrahydropyridin-4-yl)triazol-1-yl]azepane |
| SMILES | C1=C(c2cnnn2C2CCCNCC2)CCNC1 |
| InChI | InChI=1S/C13H21N5/c1-2-12(5-9-14-6-1)18-13(10-16-17-18)11-3-7-15-8-4-11/h3,10,12,14-15H,1-2,4-9H2 |
| InChIKey | UVEIRTWGCFKQEP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |