About 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole
5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole (PubChem CID 165491314) has the molecular formula C11H18ClN3
and a molecular weight of 227.74 g/mol. Its IUPAC name is 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole.
Molecular Properties
| Compound Name | 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole |
| PubChem CID | 165491314 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole |
| SMILES | Cn1nncc1C1CC(Cl)CCC1(C)C |
| InChI | InChI=1S/C11H18ClN3/c1-11(2)5-4-8(12)6-9(11)10-7-13-14-15(10)3/h7-9H,4-6H2,1-3H3 |
| InChIKey | URXFHQXBAIDTRL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole?
The IUPAC name of 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole (CID 165491314) is 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole.
What is the SMILES notation for 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole?
The canonical SMILES for 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole is Cn1nncc1C1CC(Cl)CCC1(C)C.
What is the InChIKey of 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole?
The InChIKey is URXFHQXBAIDTRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN3/c1-11(2)5-4-8(12)6-9(11)10-7-13-14-15(10)3/h7-9H,4-6H2,1-3H3.
What are the key properties of 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole?
5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole has a molecular weight of 227.74 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloro-2,2-dimethylcyclohexyl)-1-methyltriazole is sourced from PubChem (CID 165491314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).