C13H24FNO — CID 165491489
3-(4-fluoropiperidin-1-yl)-4,4-dimethylcyclohexan-1-ol (PubChem CID 165491489) has the molecular formula C13H24FNO and a molecular weight of 229.34 g/mol. Its IUPAC name is 3-(4-fluoropiperidin-1-yl)-4,4-dimethylcyclohexan-1-ol.
| Compound Name | 3-(4-fluoropiperidin-1-yl)-4,4-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 165491489 |
| Molecular Formula | C13H24FNO |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3-(4-fluoropiperidin-1-yl)-4,4-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CCC(O)CC1N1CCC(F)CC1 |
| InChI | InChI=1S/C13H24FNO/c1-13(2)6-3-11(16)9-12(13)15-7-4-10(14)5-8-15/h10-12,16H,3-9H2,1-2H3 |
| InChIKey | ULQSHSCBCONHJI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |