C15H26BrNO4 — CID 165493559
tert-butyl 4-(bromomethyl)-4-(oxolan-3-yloxy)piperidine-1-carboxylate (PubChem CID 165493559) has the molecular formula C15H26BrNO4 and a molecular weight of 364.28 g/mol. Its IUPAC name is tert-butyl 4-(bromomethyl)-4-(oxolan-3-yloxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(bromomethyl)-4-(oxolan-3-yloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 165493559 |
| Molecular Formula | C15H26BrNO4 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | tert-butyl 4-(bromomethyl)-4-(oxolan-3-yloxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CBr)(OC2CCOC2)CC1 |
| InChI | InChI=1S/C15H26BrNO4/c1-14(2,3)21-13(18)17-7-5-15(11-16,6-8-17)20-12-4-9-19-10-12/h12H,4-11H2,1-3H3 |
| InChIKey | UZPBUSWCGWQONT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|