C15H17N — CID 165494667
2,5-dimethyl-3-(3-methylphenyl)aniline (PubChem CID 165494667) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is 2,5-dimethyl-3-(3-methylphenyl)aniline.
| Compound Name | 2,5-dimethyl-3-(3-methylphenyl)aniline |
|---|---|
| PubChem CID | 165494667 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2,5-dimethyl-3-(3-methylphenyl)aniline |
| SMILES | Cc1cccc(-c2cc(C)cc(N)c2C)c1 |
| InChI | InChI=1S/C15H17N/c1-10-5-4-6-13(7-10)14-8-11(2)9-15(16)12(14)3/h4-9H,16H2,1-3H3 |
| InChIKey | WHZPTWHZSLSJBU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|