C14H13F2N — CID 165494668
3-(3,4-difluorophenyl)-2,5-dimethylaniline (PubChem CID 165494668) has the molecular formula C14H13F2N and a molecular weight of 233.26 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-2,5-dimethylaniline.
| Compound Name | 3-(3,4-difluorophenyl)-2,5-dimethylaniline |
|---|---|
| PubChem CID | 165494668 |
| Molecular Formula | C14H13F2N |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-(3,4-difluorophenyl)-2,5-dimethylaniline |
| SMILES | Cc1cc(N)c(C)c(-c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C14H13F2N/c1-8-5-11(9(2)14(17)6-8)10-3-4-12(15)13(16)7-10/h3-7H,17H2,1-2H3 |
| InChIKey | CVVHMSPNZNIMAC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|