C16H21NO4S — CID 165495132
2-[6-methyl-3-(phenylmethoxycarbonylamino)thian-3-yl]acetic acid (PubChem CID 165495132) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-[6-methyl-3-(phenylmethoxycarbonylamino)thian-3-yl]acetic acid.
| Compound Name | 2-[6-methyl-3-(phenylmethoxycarbonylamino)thian-3-yl]acetic acid |
|---|---|
| PubChem CID | 165495132 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[6-methyl-3-(phenylmethoxycarbonylamino)thian-3-yl]acetic acid |
| SMILES | CC1CCC(CC(=O)O)(NC(=O)OCc2ccccc2)CS1 |
| InChI | InChI=1S/C16H21NO4S/c1-12-7-8-16(11-22-12,9-14(18)19)17-15(20)21-10-13-5-3-2-4-6-13/h2-6,12H,7-11H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | GXSKREQVQPUBNQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |