C10H8F3N3 — CID 165495372
2,3,4-trifluoro-5-(1-methylpyrazol-4-yl)aniline (PubChem CID 165495372) has the molecular formula C10H8F3N3 and a molecular weight of 227.19 g/mol. Its IUPAC name is 2,3,4-trifluoro-5-(1-methylpyrazol-4-yl)aniline.
| Compound Name | 2,3,4-trifluoro-5-(1-methylpyrazol-4-yl)aniline |
|---|---|
| PubChem CID | 165495372 |
| Molecular Formula | C10H8F3N3 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2,3,4-trifluoro-5-(1-methylpyrazol-4-yl)aniline |
| SMILES | Cn1cc(-c2cc(N)c(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C10H8F3N3/c1-16-4-5(3-15-16)6-2-7(14)9(12)10(13)8(6)11/h2-4H,14H2,1H3 |
| InChIKey | WPBHKDZAWSHCKP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|