C14H23N3O5 — CID 165495586
3-(4-ethoxypyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 165495586) has the molecular formula C14H23N3O5 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-(4-ethoxypyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | 3-(4-ethoxypyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 165495586 |
| Molecular Formula | C14H23N3O5 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 3-(4-ethoxypyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CCOc1cnn(C(C)C(NC(=O)OC(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C14H23N3O5/c1-6-21-10-7-15-17(8-10)9(2)11(12(18)19)16-13(20)22-14(3,4)5/h7-9,11H,6H2,1-5H3,(H,16,20)(H,18,19) |
| InChIKey | MFPWFAMKMXHZHN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |