C13H20ClN3O4 — CID 165490319
3-(4-chloro-5-methylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 165490319) has the molecular formula C13H20ClN3O4 and a molecular weight of 317.77 g/mol. Its IUPAC name is 3-(4-chloro-5-methylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | 3-(4-chloro-5-methylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 165490319 |
| Molecular Formula | C13H20ClN3O4 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-(4-chloro-5-methylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | Cc1c(Cl)cnn1C(C)C(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H20ClN3O4/c1-7-9(14)6-15-17(7)8(2)10(11(18)19)16-12(20)21-13(3,4)5/h6,8,10H,1-5H3,(H,16,20)(H,18,19) |
| InChIKey | CYUZVUTWFCHTIS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |