About methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate
methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate (PubChem CID 165495989) has the molecular formula C9H13Br2N3O2
and a molecular weight of 355.03 g/mol. Its IUPAC name is methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate.
Analyze methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate?
The IUPAC name of methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate (CID 165495989) is methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate.
What is the SMILES notation for methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate?
The canonical SMILES for methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate is COC(=O)C(N)C(C)n1c(C)nc(Br)c1Br.
What is the InChIKey of methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate?
The InChIKey is UHJBWMZYRDOVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Br2N3O2/c1-4(6(12)9(15)16-3)14-5(2)13-7(10)8(14)11/h4,6H,12H2,1-3H3.
What are the key properties of methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate?
methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate has a molecular weight of 355.03 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(4,5-dibromo-2-methylimidazol-1-yl)butanoate is sourced from PubChem (CID 165495989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).