C20H24ClNO3S — CID 16549738
4-(4-chlorophenyl)sulfanyl-N-(2,5-diethoxyphenyl)butanamide (PubChem CID 16549738) has the molecular formula C20H24ClNO3S and a molecular weight of 393.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(2,5-diethoxyphenyl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(2,5-diethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 16549738 |
| Molecular Formula | C20H24ClNO3S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(2,5-diethoxyphenyl)butanamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CCCSc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H24ClNO3S/c1-3-24-16-9-12-19(25-4-2)18(14-16)22-20(23)6-5-13-26-17-10-7-15(21)8-11-17/h7-12,14H,3-6,13H2,1-2H3,(H,22,23) |
| InChIKey | JZXDMPVTNJNAFE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|