C11H18FN3 — CID 165499339
5-(cycloheptylmethyl)-4-fluoro-1H-pyrazol-3-amine (PubChem CID 165499339) has the molecular formula C11H18FN3 and a molecular weight of 211.28 g/mol. Its IUPAC name is 5-(cycloheptylmethyl)-4-fluoro-1H-pyrazol-3-amine.
| Compound Name | 5-(cycloheptylmethyl)-4-fluoro-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 165499339 |
| Molecular Formula | C11H18FN3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 5-(cycloheptylmethyl)-4-fluoro-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(CC2CCCCCC2)c1F |
| InChI | InChI=1S/C11H18FN3/c12-10-9(14-15-11(10)13)7-8-5-3-1-2-4-6-8/h8H,1-7H2,(H3,13,14,15) |
| InChIKey | VJYBRQXKJHIXFX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |