C18H13Cl4N3OS — CID 16550206
3,4,5,6-tetrachloro-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide (PubChem CID 16550206) has the molecular formula C18H13Cl4N3OS and a molecular weight of 461.20 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide.
| Compound Name | 3,4,5,6-tetrachloro-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 16550206 |
| Molecular Formula | C18H13Cl4N3OS |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 458.95 |
| IUPAC Name | 3,4,5,6-tetrachloro-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)c3nc(Cl)c(Cl)c(Cl)c3Cl)n2)c(C)c1 |
| InChI | InChI=1S/C18H13Cl4N3OS/c1-7-4-8(2)11(9(3)5-7)10-6-27-18(23-10)25-17(26)15-13(20)12(19)14(21)16(22)24-15/h4-6H,1-3H3,(H,23,25,26) |
| InChIKey | OVMQCZPXOTYZQP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|