C20H23N3O4S3 — CID 16550836
4-(1,3-benzothiazol-2-ylsulfanyl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]butanamide (PubChem CID 16550836) has the molecular formula C20H23N3O4S3 and a molecular weight of 465.62 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]butanamide |
|---|---|
| PubChem CID | 16550836 |
| Molecular Formula | C20H23N3O4S3 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]butanamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H23N3O4S3/c1-23(2)30(25,26)14-10-11-17(27-3)16(13-14)21-19(24)9-6-12-28-20-22-15-7-4-5-8-18(15)29-20/h4-5,7-8,10-11,13H,6,9,12H2,1-3H3,(H,21,24) |
| InChIKey | XRYWCORGUKILQO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|