C23H20N2O7 — CID 16550922
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 16550922) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 16550922 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(Oc1ccc2c3c(c(=O)oc2c1)CCC3)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C23H20N2O7/c26-22-18-3-1-2-16(18)17-6-5-15(13-21(17)32-22)31-23(27)19-12-14(25(28)29)4-7-20(19)24-8-10-30-11-9-24/h4-7,12-13H,1-3,8-11H2 |
| InChIKey | WSIQOAOSMXHJBM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|