C28H33N5O5 — CID 16551179
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide (PubChem CID 16551179) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide |
|---|---|
| PubChem CID | 16551179 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide |
| SMILES | CCCCN(C(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H33N5O5/c1-4-5-14-31(23-24(29)33(16-17(2)3)28(38)30-25(23)35)21(34)13-8-15-32-26(36)19-11-6-9-18-10-7-12-20(22(18)19)27(32)37/h6-7,9-12,17H,4-5,8,13-16,29H2,1-3H3,(H,30,35,38) |
| InChIKey | LZLSMRAIXIVWHM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|