C26H30N4O4 — CID 16553500
N-[(E)-[4-[2-(dimethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide (PubChem CID 16553500) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[(E)-[4-[2-(dimethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide.
| Compound Name | N-[(E)-[4-[2-(dimethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 16553500 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-[(E)-[4-[2-(dimethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cc(C)n(-c3ccccc3)c2C)ccc1OCC(=O)N(C)C |
| InChI | InChI=1S/C26H30N4O4/c1-6-33-24-15-20(12-13-23(24)34-17-25(31)29(4)5)16-27-28-26(32)22-14-18(2)30(19(22)3)21-10-8-7-9-11-21/h7-16H,6,17H2,1-5H3,(H,28,32)/b27-16+ |
| InChIKey | YVVUNCQXHLGEMD-JVWAILMASA-N |
| XLogP | 3.72 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|