C22H28N4O4 — CID 16561934
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-cyclopent-2-en-1-yl-N-(3-methoxypropyl)acetamide (PubChem CID 16561934) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-cyclopent-2-en-1-yl-N-(3-methoxypropyl)acetamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-cyclopent-2-en-1-yl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 16561934 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-cyclopent-2-en-1-yl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCN(C(=O)CC1C=CCC1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H28N4O4/c1-30-13-7-12-25(18(27)14-16-8-5-6-9-16)19-20(23)26(22(29)24-21(19)28)15-17-10-3-2-4-11-17/h2-5,8,10-11,16H,6-7,9,12-15,23H2,1H3,(H,24,28,29) |
| InChIKey | PEVCSODTHJUVJE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|