C23H24ClFN4O4 — CID 4816291
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(2-chloro-6-fluorophenyl)-N-(3-methoxypropyl)acetamide (PubChem CID 4816291) has the molecular formula C23H24ClFN4O4 and a molecular weight of 474.92 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(2-chloro-6-fluorophenyl)-N-(3-methoxypropyl)acetamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(2-chloro-6-fluorophenyl)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 4816291 |
| Molecular Formula | C23H24ClFN4O4 |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(2-chloro-6-fluorophenyl)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCN(C(=O)Cc1c(F)cccc1Cl)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H24ClFN4O4/c1-33-12-6-11-28(19(30)13-16-17(24)9-5-10-18(16)25)20-21(26)29(23(32)27-22(20)31)14-15-7-3-2-4-8-15/h2-5,7-10H,6,11-14,26H2,1H3,(H,27,31,32) |
| InChIKey | BRYJZJGNPWPUPM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|