C20H21ClN4O4S — CID 26119589
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-5-chloro-N-(3-methoxypropyl)thiophene-2-carboxamide (PubChem CID 26119589) has the molecular formula C20H21ClN4O4S and a molecular weight of 448.93 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-5-chloro-N-(3-methoxypropyl)thiophene-2-carboxamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-5-chloro-N-(3-methoxypropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26119589 |
| Molecular Formula | C20H21ClN4O4S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-5-chloro-N-(3-methoxypropyl)thiophene-2-carboxamide |
| SMILES | COCCCN(C(=O)c1ccc(Cl)s1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H21ClN4O4S/c1-29-11-5-10-24(19(27)14-8-9-15(21)30-14)16-17(22)25(20(28)23-18(16)26)12-13-6-3-2-4-7-13/h2-4,6-9H,5,10-12,22H2,1H3,(H,23,26,28) |
| InChIKey | MXKAWHXJHDZBSC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|