C21H22ClIN2O4 — CID 16564490
[2-(4-iodo-2-methylanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 16564490) has the molecular formula C21H22ClIN2O4 and a molecular weight of 528.77 g/mol. Its IUPAC name is [2-(4-iodo-2-methylanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 16564490 |
| Molecular Formula | C21H22ClIN2O4 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | Cc1cc(I)ccc1NC(=O)COC(=O)[C@@H](NC(=O)c1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C21H22ClIN2O4/c1-12(2)19(25-20(27)15-6-4-5-7-16(15)22)21(28)29-11-18(26)24-17-9-8-14(23)10-13(17)3/h4-10,12,19H,11H2,1-3H3,(H,24,26)(H,25,27)/t19-/m0/s1 |
| InChIKey | PEQJAQRVFLVFCP-IBGZPJMESA-N |
| XLogP | 4.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|