C25H36N4O2S — CID 16565085
2-[3-[2-[di(propan-2-yl)amino]ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-ethylpent-1-yn-3-yl)acetamide (PubChem CID 16565085) has the molecular formula C25H36N4O2S and a molecular weight of 456.66 g/mol. Its IUPAC name is 2-[3-[2-[di(propan-2-yl)amino]ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-ethylpent-1-yn-3-yl)acetamide.
| Compound Name | 2-[3-[2-[di(propan-2-yl)amino]ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-ethylpent-1-yn-3-yl)acetamide |
|---|---|
| PubChem CID | 16565085 |
| Molecular Formula | C25H36N4O2S |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-[3-[2-[di(propan-2-yl)amino]ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-ethylpent-1-yn-3-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CSc1nc2ccccc2c(=O)n1CCN(C(C)C)C(C)C |
| InChI | InChI=1S/C25H36N4O2S/c1-8-25(9-2,10-3)27-22(30)17-32-24-26-21-14-12-11-13-20(21)23(31)29(24)16-15-28(18(4)5)19(6)7/h1,11-14,18-19H,9-10,15-17H2,2-7H3,(H,27,30) |
| InChIKey | KTLZZYYSAGFJDI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|