C23H26N4O2S — CID 16565392
1-[2-[2-[[4-(4-methylphenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone (PubChem CID 16565392) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[2-[2-[[4-(4-methylphenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone.
| Compound Name | 1-[2-[2-[[4-(4-methylphenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 16565392 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[2-[2-[[4-(4-methylphenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCCSc1nnc(N2CCCC2)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C23H26N4O2S/c1-17-9-11-19(12-10-17)27-22(26-13-5-6-14-26)24-25-23(27)30-16-15-29-21-8-4-3-7-20(21)18(2)28/h3-4,7-12H,5-6,13-16H2,1-2H3 |
| InChIKey | MNRNTSLQBLKYDW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|