C18H20O2S — CID 43413802
1-[2-[2-(2,4-dimethylphenyl)sulfanylethoxy]phenyl]ethanone (PubChem CID 43413802) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is 1-[2-[2-(2,4-dimethylphenyl)sulfanylethoxy]phenyl]ethanone.
| Compound Name | 1-[2-[2-(2,4-dimethylphenyl)sulfanylethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 43413802 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-[2-[2-(2,4-dimethylphenyl)sulfanylethoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCCSc1ccc(C)cc1C |
| InChI | InChI=1S/C18H20O2S/c1-13-8-9-18(14(2)12-13)21-11-10-20-17-7-5-4-6-16(17)15(3)19/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | FYCMQQUOGZJPDO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|