About 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate
2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate (PubChem CID 77061098) has the molecular formula C11H15N3O2S
and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate |
| PubChem CID | 77061098 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate |
| SMILES | CC(=O)c1ccccc1OCCSC(N)=NN |
| InChI | InChI=1S/C11H15N3O2S/c1-8(15)9-4-2-3-5-10(9)16-6-7-17-11(12)14-13/h2-5H,6-7,13H2,1H3,(H2,12,14) |
| InChIKey | MHMGKHSKVWLSBT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate?
The IUPAC name of 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate (CID 77061098) is 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate.
What is the SMILES notation for 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate?
The canonical SMILES for 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate is CC(=O)c1ccccc1OCCSC(N)=NN.
What is the InChIKey of 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate?
The InChIKey is MHMGKHSKVWLSBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2S/c1-8(15)9-4-2-3-5-10(9)16-6-7-17-11(12)14-13/h2-5H,6-7,13H2,1H3,(H2,12,14).
What are the key properties of 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate?
2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate has a molecular weight of 253.33 g/mol, XLogP of 1.19, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-acetylphenoxy)ethyl N'-aminocarbamimidothioate is sourced from PubChem (CID 77061098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).