C24H23F2NO3S — CID 16566055
N-[4-[3-[bis(4-fluorophenyl)methoxy]-2-hydroxypropyl]sulfanylphenyl]acetamide (PubChem CID 16566055) has the molecular formula C24H23F2NO3S and a molecular weight of 443.52 g/mol. Its IUPAC name is N-[4-[3-[bis(4-fluorophenyl)methoxy]-2-hydroxypropyl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[3-[bis(4-fluorophenyl)methoxy]-2-hydroxypropyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 16566055 |
| Molecular Formula | C24H23F2NO3S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[4-[3-[bis(4-fluorophenyl)methoxy]-2-hydroxypropyl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SCC(O)COC(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H23F2NO3S/c1-16(28)27-21-10-12-23(13-11-21)31-15-22(29)14-30-24(17-2-6-19(25)7-3-17)18-4-8-20(26)9-5-18/h2-13,22,24,29H,14-15H2,1H3,(H,27,28) |
| InChIKey | QPXMFFUDMUPCJM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |