C23H21F3N2O4 — CID 16566350
2-[[2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 16566350) has the molecular formula C23H21F3N2O4 and a molecular weight of 446.43 g/mol. Its IUPAC name is 2-[[2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 16566350 |
| Molecular Formula | C23H21F3N2O4 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-[[2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(COc1ccc2oc3c(c2c1)CCCC3)Nc1ccccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C23H21F3N2O4/c24-23(25,26)13-27-22(30)16-6-1-3-7-18(16)28-21(29)12-31-14-9-10-20-17(11-14)15-5-2-4-8-19(15)32-20/h1,3,6-7,9-11H,2,4-5,8,12-13H2,(H,27,30)(H,28,29) |
| InChIKey | OPVLEDHUPPUJHP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |