C20H25N5O6S2 — CID 16567303
3-[[4-methyl-5-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]thiolane 1,1-dioxide (PubChem CID 16567303) has the molecular formula C20H25N5O6S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is 3-[[4-methyl-5-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[[4-methyl-5-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 16567303 |
| Molecular Formula | C20H25N5O6S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 3-[[4-methyl-5-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]thiolane 1,1-dioxide |
| SMILES | COc1cc(-c2nnc(CSc3nnc(CC4CCS(=O)(=O)C4)n3C)o2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N5O6S2/c1-25-16(7-12-5-6-33(26,27)11-12)21-24-20(25)32-10-17-22-23-19(31-17)13-8-14(28-2)18(30-4)15(9-13)29-3/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | VOXNXWLACFGFMW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 131.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |