About (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate
(3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate (PubChem CID 16572621) has the molecular formula C16H17IN2O5S
and a molecular weight of 476.29 g/mol. Its IUPAC name is (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate |
| PubChem CID | 16572621 |
| Molecular Formula | C16H17IN2O5S |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate |
| SMILES | Cn1cc(S(=O)(=O)N2CCOCC2)cc1C(=O)Oc1cccc(I)c1 |
| InChI | InChI=1S/C16H17IN2O5S/c1-18-11-14(25(21,22)19-5-7-23-8-6-19)10-15(18)16(20)24-13-4-2-3-12(17)9-13/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | HYNJHSLFYNUJLV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate?
The IUPAC name of (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate (CID 16572621) is (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate.
What is the SMILES notation for (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate?
The canonical SMILES for (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate is Cn1cc(S(=O)(=O)N2CCOCC2)cc1C(=O)Oc1cccc(I)c1.
What is the InChIKey of (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate?
The InChIKey is HYNJHSLFYNUJLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17IN2O5S/c1-18-11-14(25(21,22)19-5-7-23-8-6-19)10-15(18)16(20)24-13-4-2-3-12(17)9-13/h2-4,9-11H,5-8H2,1H3.
What are the key properties of (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate?
(3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate has a molecular weight of 476.29 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate is sourced from PubChem (CID 16572621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).