C19H22N2O8S — CID 16572627
(2-methoxy-4-methoxycarbonylphenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate (PubChem CID 16572627) has the molecular formula C19H22N2O8S and a molecular weight of 438.46 g/mol. Its IUPAC name is (2-methoxy-4-methoxycarbonylphenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate.
| Compound Name | (2-methoxy-4-methoxycarbonylphenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 16572627 |
| Molecular Formula | C19H22N2O8S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | (2-methoxy-4-methoxycarbonylphenyl) 1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2cc(S(=O)(=O)N3CCOCC3)cn2C)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O8S/c1-20-12-14(30(24,25)21-6-8-28-9-7-21)11-15(20)19(23)29-16-5-4-13(18(22)27-3)10-17(16)26-2/h4-5,10-12H,6-9H2,1-3H3 |
| InChIKey | QJAGPNDNNAAYOA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 113.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|