C19H16INO3S — CID 16572622
(3-iodophenyl) 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate (PubChem CID 16572622) has the molecular formula C19H16INO3S and a molecular weight of 465.31 g/mol. Its IUPAC name is (3-iodophenyl) 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | (3-iodophenyl) 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 16572622 |
| Molecular Formula | C19H16INO3S |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | (3-iodophenyl) 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1ccc(OCc2nc(CC(=O)Oc3cccc(I)c3)cs2)cc1 |
| InChI | InChI=1S/C19H16INO3S/c1-13-5-7-16(8-6-13)23-11-18-21-15(12-25-18)10-19(22)24-17-4-2-3-14(20)9-17/h2-9,12H,10-11H2,1H3 |
| InChIKey | JFWBBQNHDQIIMV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|