C23H23F2N3O3 — CID 16575272
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 16575272) has the molecular formula C23H23F2N3O3 and a molecular weight of 427.45 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 16575272 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2c(C)nn(-c3ccccc3)c2C)ccc1OC(F)F |
| InChI | InChI=1S/C23H23F2N3O3/c1-4-30-20-14-17(10-12-19(20)31-23(24)25)11-13-21(29)26-22-15(2)27-28(16(22)3)18-8-6-5-7-9-18/h5-14,23H,4H2,1-3H3,(H,26,29)/b13-11+ |
| InChIKey | IDIMNMZHQCNCNU-ACCUITESSA-N |
| XLogP | 5.14 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|