C23H25N3O3S — CID 16578837
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 16578837) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 16578837 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCc2cc(-c3cccs3)on2)c(C)n1CCC(C)C |
| InChI | InChI=1S/C23H25N3O3S/c1-15(2)7-8-26-16(3)10-18(17(26)4)11-19(13-24)23(27)28-14-20-12-21(29-25-20)22-6-5-9-30-22/h5-6,9-12,15H,7-8,14H2,1-4H3/b19-11+ |
| InChIKey | HCNRERMLMHYLON-YBFXNURJSA-N |
| XLogP | 5.52 |
| TPSA | 81.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|