C15H13ClN2O4 — CID 16579402
[2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 16579402) has the molecular formula C15H13ClN2O4 and a molecular weight of 320.73 g/mol. Its IUPAC name is [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16579402 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | Cc1cc(NC(=O)COC(=O)/C=C/c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C15H13ClN2O4/c1-10-8-14(22-18-10)17-13(19)9-21-15(20)7-4-11-2-5-12(16)6-3-11/h2-8H,9H2,1H3,(H,17,19)/b7-4+ |
| InChIKey | GLSVAGHETUHGJW-QPJJXVBHSA-N |
| XLogP | 2.83 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|