C21H24FN5OS — CID 16581221
1-(4-fluorophenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 16581221) has the molecular formula C21H24FN5OS and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 16581221 |
| Molecular Formula | C21H24FN5OS |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)c2nn(-c3ccc(F)cc3)c3c2CCCC3)s1 |
| InChI | InChI=1S/C21H24FN5OS/c1-2-3-4-9-18-24-25-21(29-18)23-20(28)19-16-7-5-6-8-17(16)27(26-19)15-12-10-14(22)11-13-15/h10-13H,2-9H2,1H3,(H,23,25,28) |
| InChIKey | XPJNBTRUGROPPR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|